C11H9NOS — CID 121218421
1-(3-phenyl-1,2-thiazol-5-yl)ethanone (PubChem CID 121218421) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is 1-(3-phenyl-1,2-thiazol-5-yl)ethanone.
| Compound Name | 1-(3-phenyl-1,2-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 121218421 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1-(3-phenyl-1,2-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1cc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C11H9NOS/c1-8(13)11-7-10(12-14-11)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | LLXRBAOHJMSTEW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |