C11H8ClNO2S — CID 13073226
methyl 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylate (PubChem CID 13073226) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 13073226 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(Cl)c2)ns1 |
| InChI | InChI=1S/C11H8ClNO2S/c1-15-11(14)10-6-9(13-16-10)7-3-2-4-8(12)5-7/h2-6H,1H3 |
| InChIKey | ZHOAJHKORLQLOI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |