C18H13N3OS — CID 90070616
N-[(4-cyanophenyl)methyl]-3-phenyl-1,2-thiazole-5-carboxamide (PubChem CID 90070616) has the molecular formula C18H13N3OS and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-3-phenyl-1,2-thiazole-5-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-3-phenyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90070616 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-3-phenyl-1,2-thiazole-5-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cc(-c3ccccc3)ns2)cc1 |
| InChI | InChI=1S/C18H13N3OS/c19-11-13-6-8-14(9-7-13)12-20-18(22)17-10-16(21-23-17)15-4-2-1-3-5-15/h1-10H,12H2,(H,20,22) |
| InChIKey | XXJYWFJDFPXZTG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |