C21H17N5O2 — CID 118410976
6-N-benzyl-4-N-[(4-cyanophenyl)-dideuteriomethyl]pyrimidine-4,6-dicarboxamide (PubChem CID 118410976) has the molecular formula C21H17N5O2 and a molecular weight of 373.41 g/mol. Its IUPAC name is 6-N-benzyl-4-N-[(4-cyanophenyl)-dideuteriomethyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-benzyl-4-N-[(4-cyanophenyl)-dideuteriomethyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 118410976 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 6-N-benzyl-4-N-[(4-cyanophenyl)-dideuteriomethyl]pyrimidine-4,6-dicarboxamide |
| SMILES | [2H]C([2H])(NC(=O)c1cc(C(=O)NCc2ccccc2)ncn1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H17N5O2/c22-11-15-6-8-17(9-7-15)13-24-21(28)19-10-18(25-14-26-19)20(27)23-12-16-4-2-1-3-5-16/h1-10,14H,12-13H2,(H,23,27)(H,24,28)/i13D2 |
| InChIKey | LXCRTBNCFLNQSM-KLTYLHELSA-N |
| XLogP | 2.21 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |