C21H17N5O2 — CID 70306936
N-[(4-cyanophenyl)methyl]-6-[(2-phenylacetyl)amino]pyrimidine-4-carboxamide (PubChem CID 70306936) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-6-[(2-phenylacetyl)amino]pyrimidine-4-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-6-[(2-phenylacetyl)amino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 70306936 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-6-[(2-phenylacetyl)amino]pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cc(NC(=O)Cc3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c22-12-16-6-8-17(9-7-16)13-23-21(28)18-11-19(25-14-24-18)26-20(27)10-15-4-2-1-3-5-15/h1-9,11,14H,10,13H2,(H,23,28)(H,24,25,26,27) |
| InChIKey | JKXRCBKIZNNEPS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |