C17H23N5O — CID 143601893
6-amino-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide;ethane (PubChem CID 143601893) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 6-amino-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide;ethane.
| Compound Name | 6-amino-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 143601893 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 6-amino-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide;ethane |
| SMILES | CC.CC.N#Cc1ccc(CNC(=O)c2cc(N)ncn2)cc1 |
| InChI | InChI=1S/C13H11N5O.2C2H6/c14-6-9-1-3-10(4-2-9)7-16-13(19)11-5-12(15)18-8-17-11;2*1-2/h1-5,8H,7H2,(H,16,19)(H2,15,17,18);2*1-2H3 |
| InChIKey | PHQOTCYVLMMHAU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |