C13H9ClN4O — CID 89292810
6-chloro-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 89292810) has the molecular formula C13H9ClN4O and a molecular weight of 272.70 g/mol. Its IUPAC name is 6-chloro-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-chloro-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 89292810 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-chloro-N-[(4-cyanophenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cc(Cl)ncn2)cc1 |
| InChI | InChI=1S/C13H9ClN4O/c14-12-5-11(17-8-18-12)13(19)16-7-10-3-1-9(6-15)2-4-10/h1-5,8H,7H2,(H,16,19) |
| InChIKey | YLXCVSZFVROLHM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |