C20H16ClN5O — CID 109329082
N-[(4-chlorophenyl)methyl]-2-(4-cyanoanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109329082) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(4-cyanoanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(4-cyanoanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109329082 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(4-cyanoanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(Cl)cc2)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C20H16ClN5O/c1-13-10-18(19(27)23-12-15-2-6-16(21)7-3-15)26-20(24-13)25-17-8-4-14(11-22)5-9-17/h2-10H,12H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | QHFYIXOWICUQMZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |