C19H13Cl2N5O — CID 109338146
2-(4-cyanoanilino)-N-(2,5-dichlorophenyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109338146) has the molecular formula C19H13Cl2N5O and a molecular weight of 398.25 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-(2,5-dichlorophenyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-(4-cyanoanilino)-N-(2,5-dichlorophenyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109338146 |
| Molecular Formula | C19H13Cl2N5O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-(4-cyanoanilino)-N-(2,5-dichlorophenyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(Cl)ccc2Cl)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C19H13Cl2N5O/c1-11-8-17(18(27)25-16-9-13(20)4-7-15(16)21)26-19(23-11)24-14-5-2-12(10-22)3-6-14/h2-9H,1H3,(H,25,27)(H,23,24,26) |
| InChIKey | RQVVYEHNIZNWOD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |