C19H22N6OS — CID 99813531
1-(3-phenyl-1,2-thiazol-5-yl)-3-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea (PubChem CID 99813531) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-(3-phenyl-1,2-thiazol-5-yl)-3-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea.
| Compound Name | 1-(3-phenyl-1,2-thiazol-5-yl)-3-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 99813531 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-(3-phenyl-1,2-thiazol-5-yl)-3-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
| SMILES | CC(C)c1nc2n(n1)C[C@H](NC(=O)Nc1cc(-c3ccccc3)ns1)CC2 |
| InChI | InChI=1S/C19H22N6OS/c1-12(2)18-21-16-9-8-14(11-25(16)23-18)20-19(26)22-17-10-15(24-27-17)13-6-4-3-5-7-13/h3-7,10,12,14H,8-9,11H2,1-2H3,(H2,20,22,26)/t14-/m1/s1 |
| InChIKey | NNSKKEFCGMXUHM-CQSZACIVSA-N |
| XLogP | 3.66 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |