C16H27N5OS — CID 129399870
(5R)-5-methyl-N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide (PubChem CID 129399870) has the molecular formula C16H27N5OS and a molecular weight of 337.49 g/mol. Its IUPAC name is (5R)-5-methyl-N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide.
| Compound Name | (5R)-5-methyl-N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 129399870 |
| Molecular Formula | C16H27N5OS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (5R)-5-methyl-N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide |
| SMILES | CC(C)c1nc2n(n1)C[C@H](NC(=O)N1CCSCC[C@H]1C)CC2 |
| InChI | InChI=1S/C16H27N5OS/c1-11(2)15-18-14-5-4-13(10-21(14)19-15)17-16(22)20-7-9-23-8-6-12(20)3/h11-13H,4-10H2,1-3H3,(H,17,22)/t12-,13-/m1/s1 |
| InChIKey | AYWPHWBCLWRYQT-CHWSQXEVSA-N |
| XLogP | 2.25 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |