C19H23N3O3 — CID 125163661
1-[(3R)-1-oxaspiro[4.5]decan-3-yl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 125163661) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(3R)-1-oxaspiro[4.5]decan-3-yl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | 1-[(3R)-1-oxaspiro[4.5]decan-3-yl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 125163661 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(3R)-1-oxaspiro[4.5]decan-3-yl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2cnco2)c1)N[C@H]1COC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H23N3O3/c23-18(22-16-10-19(25-12-16)7-2-1-3-8-19)21-15-6-4-5-14(9-15)17-11-20-13-24-17/h4-6,9,11,13,16H,1-3,7-8,10,12H2,(H2,21,22,23)/t16-/m1/s1 |
| InChIKey | TVRNMJNOKHSXIY-MRXNPFEDSA-N |
| XLogP | 3.95 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |