C11H13NO5S2 — CID 113421829
5-[(1,1-dioxothiane-2-carbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 113421829) has the molecular formula C11H13NO5S2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[(1,1-dioxothiane-2-carbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[(1,1-dioxothiane-2-carbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 113421829 |
| Molecular Formula | C11H13NO5S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-[(1,1-dioxothiane-2-carbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CCCCS2(=O)=O)s1 |
| InChI | InChI=1S/C11H13NO5S2/c13-10(8-3-1-2-6-19(8,16)17)12-9-5-4-7(18-9)11(14)15/h4-5,8H,1-3,6H2,(H,12,13)(H,14,15) |
| InChIKey | JCYBEZZCJHKQAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |