C10H11NO4S — CID 93058485
5-[[(2S)-oxolane-2-carbonyl]amino]thiophene-2-carboxylic acid (PubChem CID 93058485) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-[[(2S)-oxolane-2-carbonyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(2S)-oxolane-2-carbonyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 93058485 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-[[(2S)-oxolane-2-carbonyl]amino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2CCCO2)s1 |
| InChI | InChI=1S/C10H11NO4S/c12-9(6-2-1-5-15-6)11-8-4-3-7(16-8)10(13)14/h3-4,6H,1-2,5H2,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | YEWQTDGTVDKDTP-LURJTMIESA-N |
| XLogP | 1.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |