C10H10Br2O3S2 — CID 104518083
(2,5-dibromothiophen-3-yl)-(1,1-dioxothian-2-yl)methanone (PubChem CID 104518083) has the molecular formula C10H10Br2O3S2 and a molecular weight of 402.13 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(1,1-dioxothian-2-yl)methanone.
| Compound Name | (2,5-dibromothiophen-3-yl)-(1,1-dioxothian-2-yl)methanone |
|---|---|
| PubChem CID | 104518083 |
| Molecular Formula | C10H10Br2O3S2 |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.84 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(1,1-dioxothian-2-yl)methanone |
| SMILES | O=C(c1cc(Br)sc1Br)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H10Br2O3S2/c11-8-5-6(10(12)16-8)9(13)7-3-1-2-4-17(7,14)15/h5,7H,1-4H2 |
| InChIKey | FPUPWFHNQVHBTN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |