C12H11Cl3O3S — CID 105349073
(1,1-dioxothian-2-yl)-(2,4,6-trichlorophenyl)methanone (PubChem CID 105349073) has the molecular formula C12H11Cl3O3S and a molecular weight of 341.64 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(2,4,6-trichlorophenyl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(2,4,6-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 105349073 |
| Molecular Formula | C12H11Cl3O3S |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(2,4,6-trichlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)cc(Cl)cc1Cl)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H11Cl3O3S/c13-7-5-8(14)11(9(15)6-7)12(16)10-3-1-2-4-19(10,17)18/h5-6,10H,1-4H2 |
| InChIKey | KJIURBLPJJJWCL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |