C13H20O3S — CID 104518128
cyclohepten-1-yl-(1,1-dioxothian-2-yl)methanone (PubChem CID 104518128) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is cyclohepten-1-yl-(1,1-dioxothian-2-yl)methanone.
| Compound Name | cyclohepten-1-yl-(1,1-dioxothian-2-yl)methanone |
|---|---|
| PubChem CID | 104518128 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | cyclohepten-1-yl-(1,1-dioxothian-2-yl)methanone |
| SMILES | O=C(C1=CCCCCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H20O3S/c14-13(11-7-3-1-2-4-8-11)12-9-5-6-10-17(12,15)16/h7,12H,1-6,8-10H2 |
| InChIKey | UFLLTSKNSVIWGM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |