C13H16O4S — CID 174469700
2-butyl-3-prop-2-enylsulfonylcyclohexa-2,5-diene-1,4-dione (PubChem CID 174469700) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-butyl-3-prop-2-enylsulfonylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-butyl-3-prop-2-enylsulfonylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174469700 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-butyl-3-prop-2-enylsulfonylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CCS(=O)(=O)C1=C(CCCC)C(=O)C=CC1=O |
| InChI | InChI=1S/C13H16O4S/c1-3-5-6-10-11(14)7-8-12(15)13(10)18(16,17)9-4-2/h4,7-8H,2-3,5-6,9H2,1H3 |
| InChIKey | AWSCZDUESZYYMP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|