C11H14O3S — CID 123415015
2-but-3-enylidene-4-methylsulfonylcyclohex-3-en-1-one (PubChem CID 123415015) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-but-3-enylidene-4-methylsulfonylcyclohex-3-en-1-one.
| Compound Name | 2-but-3-enylidene-4-methylsulfonylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 123415015 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-but-3-enylidene-4-methylsulfonylcyclohex-3-en-1-one |
| SMILES | C=CCC=C1C=C(S(C)(=O)=O)CCC1=O |
| InChI | InChI=1S/C11H14O3S/c1-3-4-5-9-8-10(15(2,13)14)6-7-11(9)12/h3,5,8H,1,4,6-7H2,2H3 |
| InChIKey | PATYOXXPEZPTNJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|