C15H17NO3S — CID 104518071
(1,1-dioxothian-2-yl)-(6-methyl-1H-indol-3-yl)methanone (PubChem CID 104518071) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(6-methyl-1H-indol-3-yl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(6-methyl-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 104518071 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(6-methyl-1H-indol-3-yl)methanone |
| SMILES | Cc1ccc2c(C(=O)C3CCCCS3(=O)=O)c[nH]c2c1 |
| InChI | InChI=1S/C15H17NO3S/c1-10-5-6-11-12(9-16-13(11)8-10)15(17)14-4-2-3-7-20(14,18)19/h5-6,8-9,14,16H,2-4,7H2,1H3 |
| InChIKey | CLZLBOLQNBUDSE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |