C15H14N2O3S — CID 107919756
3-(1,1-dioxothiane-2-carbonyl)-1H-indole-5-carbonitrile (PubChem CID 107919756) has the molecular formula C15H14N2O3S and a molecular weight of 302.35 g/mol. Its IUPAC name is 3-(1,1-dioxothiane-2-carbonyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(1,1-dioxothiane-2-carbonyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 107919756 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-(1,1-dioxothiane-2-carbonyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C(=O)C3CCCCS3(=O)=O)c2c1 |
| InChI | InChI=1S/C15H14N2O3S/c16-8-10-4-5-13-11(7-10)12(9-17-13)15(18)14-3-1-2-6-21(14,19)20/h4-5,7,9,14,17H,1-3,6H2 |
| InChIKey | PWSQCIKHYJKPJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |