C14H14FNO3S — CID 104518074
(1,1-dioxothian-2-yl)-(6-fluoro-1H-indol-3-yl)methanone (PubChem CID 104518074) has the molecular formula C14H14FNO3S and a molecular weight of 295.33 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(6-fluoro-1H-indol-3-yl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(6-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 104518074 |
| Molecular Formula | C14H14FNO3S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(6-fluoro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2cc(F)ccc12)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H14FNO3S/c15-9-4-5-10-11(8-16-12(10)7-9)14(17)13-3-1-2-6-20(13,18)19/h4-5,7-8,13,16H,1-3,6H2 |
| InChIKey | DGLHZYUFGOWAAG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |