C15H15FN2O4S — CID 113208590
N-(1,1-dioxothiolan-3-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methyl-2-oxoacetamide (PubChem CID 113208590) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methyl-2-oxoacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 113208590 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methyl-2-oxoacetamide |
| SMILES | CN(C(=O)C(=O)c1c[nH]c2cc(F)ccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15FN2O4S/c1-18(10-4-5-23(21,22)8-10)15(20)14(19)12-7-17-13-6-9(16)2-3-11(12)13/h2-3,6-7,10,17H,4-5,8H2,1H3 |
| InChIKey | XXGASVKXECAVON-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|