C14H18ClNO2 — CID 107418935
2-chloro-5-hydroxy-N-[(2-methylcyclopentyl)methyl]benzamide (PubChem CID 107418935) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-[(2-methylcyclopentyl)methyl]benzamide.
| Compound Name | 2-chloro-5-hydroxy-N-[(2-methylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 107418935 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-chloro-5-hydroxy-N-[(2-methylcyclopentyl)methyl]benzamide |
| SMILES | CC1CCCC1CNC(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-9-3-2-4-10(9)8-16-14(18)12-7-11(17)5-6-13(12)15/h5-7,9-10,17H,2-4,8H2,1H3,(H,16,18) |
| InChIKey | DXODARBHEMQBCL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |