C10H12ClN3O3S — CID 107258047
5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyrazine-2-carboxamide (PubChem CID 107258047) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107258047 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H12ClN3O3S/c11-9-6-12-8(5-13-9)10(15)14-4-7-2-1-3-18(7,16)17/h5-7H,1-4H2,(H,14,15) |
| InChIKey | SRPPZHMRKNUXFW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |