C11H15N3O3S — CID 81040301
4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 81040301) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 81040301 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | Nc1ccnc(C(=O)NCC2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H15N3O3S/c12-8-3-4-13-10(6-8)11(15)14-7-9-2-1-5-18(9,16)17/h3-4,6,9H,1-2,5,7H2,(H2,12,13)(H,14,15) |
| InChIKey | FPCWRMHDBYPSAS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |