C14H16N2O4S — CID 81042497
5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 81042497) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 81042497 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccc2oc(C(=O)NCC3CCCS3(=O)=O)cc2c1 |
| InChI | InChI=1S/C14H16N2O4S/c15-10-3-4-12-9(6-10)7-13(20-12)14(17)16-8-11-2-1-5-21(11,18)19/h3-4,6-7,11H,1-2,5,8,15H2,(H,16,17) |
| InChIKey | NQBFXQDOUMHYDN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|