C18H24N2O5 — CID 11886493
N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide (PubChem CID 11886493) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 11886493 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H24N2O5/c21-18(20-6-8-22-9-7-20)19-14-11-24-17-15(12-25-16(14)17)23-10-13-4-2-1-3-5-13/h1-5,14-17H,6-12H2,(H,19,21)/t14-,15+,16+,17+/m0/s1 |
| InChIKey | GDCUYZWHORZJMO-YLFCFFPRSA-N |
| XLogP | 0.78 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |