C18H22N6O5 — CID 11886180
N-[(3S,3aR,6S,6aR)-6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide (PubChem CID 11886180) has the molecular formula C18H22N6O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 11886180 |
| Molecular Formula | C18H22N6O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1Oc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H22N6O5/c25-17(23-6-8-26-9-7-23)19-13-10-27-16-14(11-28-15(13)16)24-18(20-21-22-24)29-12-4-2-1-3-5-12/h1-5,13-16H,6-11H2,(H,19,25)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | OZGWPLXVSWCEDP-CAOSSQGBSA-N |
| XLogP | 0.21 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |