C20H23N9O5 — CID 73134515
N-[6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide (PubChem CID 73134515) has the molecular formula C20H23N9O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is N-[6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 73134515 |
| Molecular Formula | C20H23N9O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
| SMILES | O=C(NC1COC2C1OCC2n1nnnc1Oc1ccc(-n2cncn2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23N9O5/c30-19(27-5-7-31-8-6-27)23-15-9-32-18-16(10-33-17(15)18)29-20(24-25-26-29)34-14-3-1-13(2-4-14)28-12-21-11-22-28/h1-4,11-12,15-18H,5-10H2,(H,23,30) |
| InChIKey | IRPIGZZQUQCABR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |