C23H20F3N9O4 — CID 11886263
1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 11886263) has the molecular formula C23H20F3N9O4 and a molecular weight of 543.47 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11886263 |
| Molecular Formula | C23H20F3N9O4 |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1Oc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C23H20F3N9O4/c24-23(25,26)13-2-1-3-14(8-13)29-21(36)30-17-9-37-20-18(10-38-19(17)20)35-22(31-32-33-35)39-16-6-4-15(5-7-16)34-12-27-11-28-34/h1-8,11-12,17-20H,9-10H2,(H2,29,30,36)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | XZGQAKYBLRYONU-VNTMZGSJSA-N |
| XLogP | 2.59 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |