C28H27N8O3+ — CID 11886280
[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(4-phenylphenyl)methyl]azanium (PubChem CID 11886280) has the molecular formula C28H27N8O3+ and a molecular weight of 523.58 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(4-phenylphenyl)methyl]azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(4-phenylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 11886280 |
| Molecular Formula | C28H27N8O3+ |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(4-phenylphenyl)methyl]azanium |
| SMILES | c1ccc(-c2ccc(C[NH2+][C@H]3CO[C@H]4[C@@H]3OC[C@@H]4n3nnnc3Oc3ccc(-n4cncn4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N8O3/c1-2-4-20(5-3-1)21-8-6-19(7-9-21)14-30-24-15-37-27-25(16-38-26(24)27)36-28(32-33-34-36)39-23-12-10-22(11-13-23)35-18-29-17-31-35/h1-13,17-18,24-27,30H,14-16H2/p+1/t24-,25-,26+,27+/m0/s1 |
| InChIKey | SARWSCGPOUFWGK-GWMMUDDPSA-O |
| XLogP | 2.18 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |