C22H27N9O4 — CID 11886262
1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea (PubChem CID 11886262) has the molecular formula C22H27N9O4 and a molecular weight of 481.52 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 11886262 |
| Molecular Formula | C22H27N9O4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1Oc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C22H27N9O4/c32-21(25-14-4-2-1-3-5-14)26-17-10-33-20-18(11-34-19(17)20)31-22(27-28-29-31)35-16-8-6-15(7-9-16)30-13-23-12-24-30/h6-9,12-14,17-20H,1-5,10-11H2,(H2,25,26,32)/t17-,18-,19+,20+/m0/s1 |
| InChIKey | GQGLVGLUBUIBMG-VNTMZGSJSA-N |
| XLogP | 1.39 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |