C21H26N7O3+ — CID 11867551
[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(pyridin-2-ylmethyl)azanium (PubChem CID 11867551) has the molecular formula C21H26N7O3+ and a molecular weight of 424.49 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(pyridin-2-ylmethyl)azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 11867551 |
| Molecular Formula | C21H26N7O3+ |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(pyridin-2-ylmethyl)azanium |
| SMILES | CN(C)c1cccc(Oc2nnnn2[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3[NH2+]Cc2ccccn2)c1 |
| InChI | InChI=1S/C21H25N7O3/c1-27(2)15-7-5-8-16(10-15)31-21-24-25-26-28(21)18-13-30-19-17(12-29-20(18)19)23-11-14-6-3-4-9-22-14/h3-10,17-20,23H,11-13H2,1-2H3/p+1/t17-,18-,19+,20+/m0/s1 |
| InChIKey | BILBSWMBFCNYSH-VNTMZGSJSA-O |
| XLogP | 0.40 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |