C22H30N6O6 — CID 162963964
5-[[(3R,3aR,6S,6aS)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 162963964) has the molecular formula C22H30N6O6 and a molecular weight of 474.52 g/mol. Its IUPAC name is 5-[[(3R,3aR,6S,6aS)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[[(3R,3aR,6S,6aS)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 162963964 |
| Molecular Formula | C22H30N6O6 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 5-[[(3R,3aR,6S,6aS)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CN(C)c1cccc(Oc2nnnn2[C@H]2CO[C@H]3[C@H]2OC[C@H]3NC(=O)CC(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C22H30N6O6/c1-22(2,10-18(30)31)9-17(29)23-15-11-32-20-16(12-33-19(15)20)28-21(24-25-26-28)34-14-7-5-6-13(8-14)27(3)4/h5-8,15-16,19-20H,9-12H2,1-4H3,(H,23,29)(H,30,31)/t15-,16+,19-,20+/m1/s1 |
| InChIKey | ZYHBESMQLKQEGX-GJJHYRHESA-N |
| XLogP | 1.25 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |