C24H32N6O5 — CID 73132334
N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide (PubChem CID 73132334) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 73132334 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(NC1COC2C1OCC2n1nnnc1Oc1cccc(N2CCOCC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H32N6O5/c31-23(16-5-2-1-3-6-16)25-19-14-33-22-20(15-34-21(19)22)30-24(26-27-28-30)35-18-8-4-7-17(13-18)29-9-11-32-12-10-29/h4,7-8,13,16,19-22H,1-3,5-6,9-12,14-15H2,(H,25,31) |
| InChIKey | GFCOBHXLHPNJHV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |