C24H25N7O6S — CID 73132348
2-cyano-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide (PubChem CID 73132348) has the molecular formula C24H25N7O6S and a molecular weight of 539.57 g/mol. Its IUPAC name is 2-cyano-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide.
| Compound Name | 2-cyano-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 73132348 |
| Molecular Formula | C24H25N7O6S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-cyano-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NC1COC2C1OCC2n1nnnc1Oc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C24H25N7O6S/c25-13-16-4-1-2-7-21(16)38(32,33)27-19-14-35-23-20(15-36-22(19)23)31-24(26-28-29-31)37-18-6-3-5-17(12-18)30-8-10-34-11-9-30/h1-7,12,19-20,22-23,27H,8-11,14-15H2 |
| InChIKey | ZHVWVXORYJKOHB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |