C24H33N7O4S — CID 162806536
1-[(3S,3aS,6R,6aR)-6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea (PubChem CID 162806536) has the molecular formula C24H33N7O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is 1-[(3S,3aS,6R,6aR)-6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea.
| Compound Name | 1-[(3S,3aS,6R,6aR)-6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 162806536 |
| Molecular Formula | C24H33N7O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 1-[(3S,3aS,6R,6aR)-6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea |
| SMILES | S=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1nnnc1Oc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C24H33N7O4S/c36-23(25-16-5-2-1-3-6-16)26-19-14-33-22-20(15-34-21(19)22)31-24(27-28-29-31)35-18-8-4-7-17(13-18)30-9-11-32-12-10-30/h4,7-8,13,16,19-22H,1-3,5-6,9-12,14-15H2,(H2,25,26,36)/t19-,20+,21-,22+/m0/s1 |
| InChIKey | YHBVLTMCBZPCGM-LNRXMEIDSA-N |
| XLogP | 1.81 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|