C22H35N5O2S — CID 162879529
1-[(3S,3aS,6R,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea (PubChem CID 162879529) has the molecular formula C22H35N5O2S and a molecular weight of 433.62 g/mol. Its IUPAC name is 1-[(3S,3aS,6R,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea.
| Compound Name | 1-[(3S,3aS,6R,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 162879529 |
| Molecular Formula | C22H35N5O2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[(3S,3aS,6R,6aR)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylthiourea |
| SMILES | S=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1cc(CC2CCCCC2)nn1 |
| InChI | InChI=1S/C22H35N5O2S/c30-22(23-16-9-5-2-6-10-16)24-18-13-28-21-19(14-29-20(18)21)27-12-17(25-26-27)11-15-7-3-1-4-8-15/h12,15-16,18-21H,1-11,13-14H2,(H2,23,24,30)/t18-,19+,20-,21+/m0/s1 |
| InChIKey | CBQVJGFATGHJLW-JSXRDJHFSA-N |
| XLogP | 2.90 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|