C23H30N4O4 — CID 162806965
N-[(3R,3aR,6S,6aS)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide (PubChem CID 162806965) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(3R,3aR,6S,6aS)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(3R,3aR,6S,6aS)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 162806965 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(3R,3aR,6S,6aS)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CO[C@@H]3[C@@H]2OC[C@@H]3n2cc(CC3CCCCC3)nn2)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-29-18-9-7-16(8-10-18)23(28)24-19-13-30-22-20(14-31-21(19)22)27-12-17(25-26-27)11-15-5-3-2-4-6-15/h7-10,12,15,19-22H,2-6,11,13-14H2,1H3,(H,24,28)/t19-,20+,21-,22+/m1/s1 |
| InChIKey | JJROYFCOPWJMRO-MBDNFAEBSA-N |
| XLogP | 2.55 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |