C20H31N5O4 — CID 73138829
N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide (PubChem CID 73138829) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 73138829 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]morpholine-4-carboxamide |
| SMILES | O=C(NC1COC2C1OCC2n1cc(CC2CCCCC2)nn1)N1CCOCC1 |
| InChI | InChI=1S/C20H31N5O4/c26-20(24-6-8-27-9-7-24)21-16-12-28-19-17(13-29-18(16)19)25-11-15(22-23-25)10-14-4-2-1-3-5-14/h11,14,16-19H,1-10,12-13H2,(H,21,26) |
| InChIKey | DRJKNPWOZOKAMV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |