C22H32N4O4 — CID 143860817
N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-3-carboxamide;ethane (PubChem CID 143860817) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-3-carboxamide;ethane.
| Compound Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143860817 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-3-carboxamide;ethane |
| SMILES | CC.O=C(NC1COC2C1OCC2n1cc(CC2CCCCC2)nn1)c1ccoc1 |
| InChI | InChI=1S/C20H26N4O4.C2H6/c25-20(14-6-7-26-10-14)21-16-11-27-19-17(12-28-18(16)19)24-9-15(22-23-24)8-13-4-2-1-3-5-13;1-2/h6-7,9-10,13,16-19H,1-5,8,11-12H2,(H,21,25);1-2H3 |
| InChIKey | SVRIYVJDNVWUKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |