C21H36N4O3 — CID 143860720
N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methylpropanamide;ethane (PubChem CID 143860720) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methylpropanamide;ethane.
| Compound Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methylpropanamide;ethane |
|---|---|
| PubChem CID | 143860720 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methylpropanamide;ethane |
| SMILES | CC.CC(C)C(=O)NC1COC2C1OCC2n1cc(CC2CCCCC2)nn1 |
| InChI | InChI=1S/C19H30N4O3.C2H6/c1-12(2)19(24)20-15-10-25-18-16(11-26-17(15)18)23-9-14(21-22-23)8-13-6-4-3-5-7-13;1-2/h9,12-13,15-18H,3-8,10-11H2,1-2H3,(H,20,24);1-2H3 |
| InChIKey | AJUCAIPFVURBOC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |