C20H26N4O3S — CID 70968804
N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-carboxamide (PubChem CID 70968804) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70968804 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1COC2C1OCC2n1cc(CC2CCCCC2)nn1)c1cccs1 |
| InChI | InChI=1S/C20H26N4O3S/c25-20(17-7-4-8-28-17)21-15-11-26-19-16(12-27-18(15)19)24-10-14(22-23-24)9-13-5-2-1-3-6-13/h4,7-8,10,13,15-16,18-19H,1-3,5-6,9,11-12H2,(H,21,25) |
| InChIKey | IZQHEBBOGYLXSM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |