C23H21F3N4O4 — CID 11941636
N-[(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 11941636) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11941636 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1cc(COc2ccccc2)nn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N4O4/c24-23(25,26)15-8-6-14(7-9-15)22(31)27-18-12-33-21-19(13-34-20(18)21)30-10-16(28-29-30)11-32-17-4-2-1-3-5-17/h1-10,18-21H,11-13H2,(H,27,31)/t18-,19-,20+,21+/m0/s1 |
| InChIKey | TZBYLQNXORIGTQ-UWHLTILDSA-N |
| XLogP | 3.01 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |