C16H20N4O5S — CID 163140931
N-[(3R,3aR,6S,6aS)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanesulfonamide (PubChem CID 163140931) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[(3R,3aR,6S,6aS)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,3aR,6S,6aS)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 163140931 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(3R,3aR,6S,6aS)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CO[C@@H]2[C@@H]1OC[C@@H]2n1cc(COc2ccccc2)nn1 |
| InChI | InChI=1S/C16H20N4O5S/c1-26(21,22)18-13-9-24-16-14(10-25-15(13)16)20-7-11(17-19-20)8-23-12-5-3-2-4-6-12/h2-7,13-16,18H,8-10H2,1H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | JTMGAWFDYCHDTP-QXSJWSMHSA-N |
| XLogP | 0.11 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |