C21H29N5O2 — CID 11912017
(3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-N-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 11912017) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-N-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | (3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-N-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 11912017 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-N-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | CN(Cc1ccccc1)Cc1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NCC2CC2)nn1 |
| InChI | InChI=1S/C21H29N5O2/c1-25(10-16-5-3-2-4-6-16)11-17-12-26(24-23-17)19-14-28-20-18(13-27-21(19)20)22-9-15-7-8-15/h2-6,12,15,18-22H,7-11,13-14H2,1H3/t18-,19-,20+,21+/m0/s1 |
| InChIKey | WOYJFYGZFXSOSW-UWHLTILDSA-N |
| XLogP | 1.62 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |