C21H26N5O4S2+ — CID 11911879
[1-[(3S,3aR,6S,6aR)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-benzyl-methylazanium (PubChem CID 11911879) has the molecular formula C21H26N5O4S2+ and a molecular weight of 476.60 g/mol. Its IUPAC name is [1-[(3S,3aR,6S,6aR)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-benzyl-methylazanium.
| Compound Name | [1-[(3S,3aR,6S,6aR)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-benzyl-methylazanium |
|---|---|
| PubChem CID | 11911879 |
| Molecular Formula | C21H26N5O4S2+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [1-[(3S,3aR,6S,6aR)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-benzyl-methylazanium |
| SMILES | C[NH+](Cc1ccccc1)Cc1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NS(=O)(=O)c2cccs2)nn1 |
| InChI | InChI=1S/C21H25N5O4S2/c1-25(10-15-6-3-2-4-7-15)11-16-12-26(24-22-16)18-14-30-20-17(13-29-21(18)20)23-32(27,28)19-8-5-9-31-19/h2-9,12,17-18,20-21,23H,10-11,13-14H2,1H3/p+1/t17-,18-,20+,21+/m0/s1 |
| InChIKey | MKHQKVBOUFDPRQ-FMWKFLBASA-O |
| XLogP | 0.24 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |