C12H15N3O3S2 — CID 128992375
N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]thiophene-2-sulfonamide (PubChem CID 128992375) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 128992375 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]thiophene-2-sulfonamide |
| SMILES | Cn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-15-8-9(7-13-15)12-10(4-5-18-12)14-20(16,17)11-3-2-6-19-11/h2-3,6-8,10,12,14H,4-5H2,1H3/t10-,12+/m0/s1 |
| InChIKey | JTSXUKBWZDOEJO-CMPLNLGQSA-N |
| XLogP | 1.29 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |