C14H17N3O2S — CID 128997659
N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]thiophene-2-carboxamide (PubChem CID 128997659) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 128997659 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]thiophene-2-carboxamide |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2NC(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C14H17N3O2S/c1-17-9-10(8-15-17)13-11(4-2-6-19-13)16-14(18)12-5-3-7-20-12/h3,5,7-9,11,13H,2,4,6H2,1H3,(H,16,18)/t11-,13+/m0/s1 |
| InChIKey | HYIBCWPTQZNSPT-WCQYABFASA-N |
| XLogP | 2.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |